C29H26N2O3 — CID 17073450
4-phenyl-N'-[2-(4-phenylphenoxy)butanoyl]benzohydrazide (PubChem CID 17073450) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-phenyl-N'-[2-(4-phenylphenoxy)butanoyl]benzohydrazide.
| Compound Name | 4-phenyl-N'-[2-(4-phenylphenoxy)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 17073450 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 4-phenyl-N'-[2-(4-phenylphenoxy)butanoyl]benzohydrazide |
| SMILES | CCC(Oc1ccc(-c2ccccc2)cc1)C(=O)NNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N2O3/c1-2-27(34-26-19-17-24(18-20-26)22-11-7-4-8-12-22)29(33)31-30-28(32)25-15-13-23(14-16-25)21-9-5-3-6-10-21/h3-20,27H,2H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | JHNLLWOLJPDDHT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|