C23H21ClN2O3 — CID 17073460
2-chloro-N'-[2-(4-phenylphenoxy)butanoyl]benzohydrazide (PubChem CID 17073460) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is 2-chloro-N'-[2-(4-phenylphenoxy)butanoyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(4-phenylphenoxy)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 17073460 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-chloro-N'-[2-(4-phenylphenoxy)butanoyl]benzohydrazide |
| SMILES | CCC(Oc1ccc(-c2ccccc2)cc1)C(=O)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H21ClN2O3/c1-2-21(23(28)26-25-22(27)19-10-6-7-11-20(19)24)29-18-14-12-17(13-15-18)16-8-4-3-5-9-16/h3-15,21H,2H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | NMBMJYGNKZDNJP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|