C24H24N2O4 — CID 17112731
N'-[4-(2-ethoxyethoxy)benzoyl]-4-phenylbenzohydrazide (PubChem CID 17112731) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N'-[4-(2-ethoxyethoxy)benzoyl]-4-phenylbenzohydrazide.
| Compound Name | N'-[4-(2-ethoxyethoxy)benzoyl]-4-phenylbenzohydrazide |
|---|---|
| PubChem CID | 17112731 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N'-[4-(2-ethoxyethoxy)benzoyl]-4-phenylbenzohydrazide |
| SMILES | CCOCCOc1ccc(C(=O)NNC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-2-29-16-17-30-22-14-12-21(13-15-22)24(28)26-25-23(27)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-15H,2,16-17H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | AJBZSYSXUDFDEA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|