C23H22N2O3 — CID 4951976
4-methyl-N'-[2-(4-phenylphenoxy)propanoyl]benzohydrazide (PubChem CID 4951976) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-methyl-N'-[2-(4-phenylphenoxy)propanoyl]benzohydrazide.
| Compound Name | 4-methyl-N'-[2-(4-phenylphenoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 4951976 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 4-methyl-N'-[2-(4-phenylphenoxy)propanoyl]benzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)C(C)Oc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O3/c1-16-8-10-20(11-9-16)23(27)25-24-22(26)17(2)28-21-14-12-19(13-15-21)18-6-4-3-5-7-18/h3-15,17H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | ZBLGYHJZETTXLA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|