C23H24N2O4 — CID 8757605
(2R)-2-(4-methylphenoxy)-N'-[(2R)-2-naphthalen-2-yloxypropanoyl]propanehydrazide (PubChem CID 8757605) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (2R)-2-(4-methylphenoxy)-N'-[(2R)-2-naphthalen-2-yloxypropanoyl]propanehydrazide.
| Compound Name | (2R)-2-(4-methylphenoxy)-N'-[(2R)-2-naphthalen-2-yloxypropanoyl]propanehydrazide |
|---|---|
| PubChem CID | 8757605 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2R)-2-(4-methylphenoxy)-N'-[(2R)-2-naphthalen-2-yloxypropanoyl]propanehydrazide |
| SMILES | Cc1ccc(O[C@H](C)C(=O)NNC(=O)[C@@H](C)Oc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-15-8-11-20(12-9-15)28-16(2)22(26)24-25-23(27)17(3)29-21-13-10-18-6-4-5-7-19(18)14-21/h4-14,16-17H,1-3H3,(H,24,26)(H,25,27)/t16-,17-/m1/s1 |
| InChIKey | RVYUYKCAZBPVBB-IAGOWNOFSA-N |
| XLogP | 3.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|