C25H28N2O4 — CID 7927374
(2R)-N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-naphthalen-2-yloxypropanehydrazide (PubChem CID 7927374) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2R)-N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-naphthalen-2-yloxypropanehydrazide.
| Compound Name | (2R)-N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-naphthalen-2-yloxypropanehydrazide |
|---|---|
| PubChem CID | 7927374 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (2R)-N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-naphthalen-2-yloxypropanehydrazide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NNC(=O)[C@@H](C)Oc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C25H28N2O4/c1-16(2)22-12-9-17(3)13-23(22)30-15-24(28)26-27-25(29)18(4)31-21-11-10-19-7-5-6-8-20(19)14-21/h5-14,16,18H,15H2,1-4H3,(H,26,28)(H,27,29)/t18-/m1/s1 |
| InChIKey | ONJWUOZZQGXOFB-GOSISDBHSA-N |
| XLogP | 4.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|