C22H19N3O4 — CID 8008591
(2R)-N'-[2-(2-cyanophenoxy)acetyl]-2-naphthalen-2-yloxypropanehydrazide (PubChem CID 8008591) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is (2R)-N'-[2-(2-cyanophenoxy)acetyl]-2-naphthalen-2-yloxypropanehydrazide.
| Compound Name | (2R)-N'-[2-(2-cyanophenoxy)acetyl]-2-naphthalen-2-yloxypropanehydrazide |
|---|---|
| PubChem CID | 8008591 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (2R)-N'-[2-(2-cyanophenoxy)acetyl]-2-naphthalen-2-yloxypropanehydrazide |
| SMILES | C[C@@H](Oc1ccc2ccccc2c1)C(=O)NNC(=O)COc1ccccc1C#N |
| InChI | InChI=1S/C22H19N3O4/c1-15(29-19-11-10-16-6-2-3-7-17(16)12-19)22(27)25-24-21(26)14-28-20-9-5-4-8-18(20)13-23/h2-12,15H,14H2,1H3,(H,24,26)(H,25,27)/t15-/m1/s1 |
| InChIKey | BXGCZKSYYYZVBL-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|