C22H20N2O3 — CID 6234718
2-naphthalen-2-yloxy-N'-[(E)-3-phenylprop-2-enoyl]propanehydrazide (PubChem CID 6234718) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-naphthalen-2-yloxy-N'-[(E)-3-phenylprop-2-enoyl]propanehydrazide.
| Compound Name | 2-naphthalen-2-yloxy-N'-[(E)-3-phenylprop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 6234718 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-naphthalen-2-yloxy-N'-[(E)-3-phenylprop-2-enoyl]propanehydrazide |
| SMILES | CC(Oc1ccc2ccccc2c1)C(=O)NNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H20N2O3/c1-16(27-20-13-12-18-9-5-6-10-19(18)15-20)22(26)24-23-21(25)14-11-17-7-3-2-4-8-17/h2-16H,1H3,(H,23,25)(H,24,26)/b14-11+ |
| InChIKey | BXXRWHMQAYKMKR-SDNWHVSQSA-N |
| XLogP | 3.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|