C18H20N2O5 — CID 8757642
5-[2-[(2S)-2-naphthalen-2-yloxypropanoyl]hydrazinyl]-5-oxopentanoic acid (PubChem CID 8757642) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 5-[2-[(2S)-2-naphthalen-2-yloxypropanoyl]hydrazinyl]-5-oxopentanoic acid.
| Compound Name | 5-[2-[(2S)-2-naphthalen-2-yloxypropanoyl]hydrazinyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 8757642 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 5-[2-[(2S)-2-naphthalen-2-yloxypropanoyl]hydrazinyl]-5-oxopentanoic acid |
| SMILES | C[C@H](Oc1ccc2ccccc2c1)C(=O)NNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C18H20N2O5/c1-12(18(24)20-19-16(21)7-4-8-17(22)23)25-15-10-9-13-5-2-3-6-14(13)11-15/h2-3,5-6,9-12H,4,7-8H2,1H3,(H,19,21)(H,20,24)(H,22,23)/t12-/m0/s1 |
| InChIKey | GOKOXQUUTNWSJU-LBPRGKRZSA-N |
| XLogP | 2.01 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|