C24H23N3O5 — CID 43003636
N'-(2-naphthalen-2-yloxypropanoyl)-4-(2-oxo-1,3-benzoxazol-3-yl)butanehydrazide (PubChem CID 43003636) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is N'-(2-naphthalen-2-yloxypropanoyl)-4-(2-oxo-1,3-benzoxazol-3-yl)butanehydrazide.
| Compound Name | N'-(2-naphthalen-2-yloxypropanoyl)-4-(2-oxo-1,3-benzoxazol-3-yl)butanehydrazide |
|---|---|
| PubChem CID | 43003636 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N'-(2-naphthalen-2-yloxypropanoyl)-4-(2-oxo-1,3-benzoxazol-3-yl)butanehydrazide |
| SMILES | CC(Oc1ccc2ccccc2c1)C(=O)NNC(=O)CCCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C24H23N3O5/c1-16(31-19-13-12-17-7-2-3-8-18(17)15-19)23(29)26-25-22(28)11-6-14-27-20-9-4-5-10-21(20)32-24(27)30/h2-5,7-10,12-13,15-16H,6,11,14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | MOJONJLBJQARQK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|