C23H21N3O5 — CID 55379563
2-naphthalen-2-yloxy-N'-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyl]propanehydrazide (PubChem CID 55379563) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-naphthalen-2-yloxy-N'-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyl]propanehydrazide.
| Compound Name | 2-naphthalen-2-yloxy-N'-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 55379563 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-naphthalen-2-yloxy-N'-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyl]propanehydrazide |
| SMILES | CC(Oc1ccc2ccccc2c1)C(=O)NNC(=O)CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C23H21N3O5/c1-15(30-18-11-10-16-6-2-3-7-17(16)14-18)22(28)25-24-21(27)12-13-26-19-8-4-5-9-20(19)31-23(26)29/h2-11,14-15H,12-13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | HUBQZFBVCWTREN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|