C17H22N2O5 — CID 18204942
propan-2-yl 3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]propanoate (PubChem CID 18204942) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is propan-2-yl 3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]propanoate.
| Compound Name | propan-2-yl 3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]propanoate |
|---|---|
| PubChem CID | 18204942 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | propan-2-yl 3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)CCCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C17H22N2O5/c1-12(2)23-16(21)9-10-18-15(20)8-5-11-19-13-6-3-4-7-14(13)24-17(19)22/h3-4,6-7,12H,5,8-11H2,1-2H3,(H,18,20) |
| InChIKey | GKULBUFLJULLJL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |