C18H24N2O5 — CID 9221034
methyl 6-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]hexanoate (PubChem CID 9221034) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 6-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]hexanoate.
| Compound Name | methyl 6-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]hexanoate |
|---|---|
| PubChem CID | 9221034 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | methyl 6-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CCCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C18H24N2O5/c1-24-17(22)11-3-2-6-12-19-16(21)10-7-13-20-14-8-4-5-9-15(14)25-18(20)23/h4-5,8-9H,2-3,6-7,10-13H2,1H3,(H,19,21) |
| InChIKey | KPNKHAJDLMVWHK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|