C19H20N2O3 — CID 27844689
3-(2-oxo-1,3-benzoxazol-3-yl)-N-(3-phenylpropyl)propanamide (PubChem CID 27844689) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(2-oxo-1,3-benzoxazol-3-yl)-N-(3-phenylpropyl)propanamide.
| Compound Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 27844689 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-(3-phenylpropyl)propanamide |
| SMILES | O=C(CCn1c(=O)oc2ccccc21)NCCCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c22-18(20-13-6-9-15-7-2-1-3-8-15)12-14-21-16-10-4-5-11-17(16)24-19(21)23/h1-5,7-8,10-11H,6,9,12-14H2,(H,20,22) |
| InChIKey | CWTSHVXZZYAMQT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|