C22H25N3O4 — CID 86986290
N-butyl-4-[[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]methyl]benzamide (PubChem CID 86986290) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-butyl-4-[[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]methyl]benzamide.
| Compound Name | N-butyl-4-[[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 86986290 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-butyl-4-[[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]methyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(CNC(=O)CCn2c(=O)oc3ccccc32)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-2-3-13-23-21(27)17-10-8-16(9-11-17)15-24-20(26)12-14-25-18-6-4-5-7-19(18)29-22(25)28/h4-11H,2-3,12-15H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | QKJMIDXQOPOVTJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|