C19H27N3O4 — CID 47041811
N-(4-morpholin-4-ylbutyl)-4-(2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 47041811) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-(4-morpholin-4-ylbutyl)-4-(2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-(4-morpholin-4-ylbutyl)-4-(2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 47041811 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-(4-morpholin-4-ylbutyl)-4-(2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)NCCCCN1CCOCC1 |
| InChI | InChI=1S/C19H27N3O4/c23-18(20-9-3-4-10-21-12-14-25-15-13-21)8-5-11-22-16-6-1-2-7-17(16)26-19(22)24/h1-2,6-7H,3-5,8-15H2,(H,20,23) |
| InChIKey | MZGQAWNOSMQQPJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|