C20H22N2O3 — CID 7105736
3-(2-oxo-1,3-benzoxazol-3-yl)-N-[(2S)-4-phenylbutan-2-yl]propanamide (PubChem CID 7105736) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[(2S)-4-phenylbutan-2-yl]propanamide.
| Compound Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[(2S)-4-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 7105736 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[(2S)-4-phenylbutan-2-yl]propanamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C20H22N2O3/c1-15(11-12-16-7-3-2-4-8-16)21-19(23)13-14-22-17-9-5-6-10-18(17)25-20(22)24/h2-10,15H,11-14H2,1H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | GVOQRDVDMLIVLK-HNNXBMFYSA-N |
| XLogP | 3.12 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |