C24H32N2O2 — CID 7409928
N,N'-bis[(2S)-4-phenylbutan-2-yl]butanediamide (PubChem CID 7409928) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N,N'-bis[(2S)-4-phenylbutan-2-yl]butanediamide.
| Compound Name | N,N'-bis[(2S)-4-phenylbutan-2-yl]butanediamide |
|---|---|
| PubChem CID | 7409928 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N,N'-bis[(2S)-4-phenylbutan-2-yl]butanediamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)CCC(=O)N[C@@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C24H32N2O2/c1-19(13-15-21-9-5-3-6-10-21)25-23(27)17-18-24(28)26-20(2)14-16-22-11-7-4-8-12-22/h3-12,19-20H,13-18H2,1-2H3,(H,25,27)(H,26,28)/t19-,20-/m0/s1 |
| InChIKey | VXNAOWWIQQHKSN-PMACEKPBSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |