C26H36N2O2 — CID 7406180
N,N'-bis[(2R)-4-phenylbutan-2-yl]hexanediamide (PubChem CID 7406180) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N,N'-bis[(2R)-4-phenylbutan-2-yl]hexanediamide.
| Compound Name | N,N'-bis[(2R)-4-phenylbutan-2-yl]hexanediamide |
|---|---|
| PubChem CID | 7406180 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | N,N'-bis[(2R)-4-phenylbutan-2-yl]hexanediamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)CCCCC(=O)N[C@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C26H36N2O2/c1-21(17-19-23-11-5-3-6-12-23)27-25(29)15-9-10-16-26(30)28-22(2)18-20-24-13-7-4-8-14-24/h3-8,11-14,21-22H,9-10,15-20H2,1-2H3,(H,27,29)(H,28,30)/t21-,22-/m1/s1 |
| InChIKey | YNMNRUWMCQZSNC-FGZHOGPDSA-N |
| XLogP | 4.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|