C26H36N2O2S — CID 4172358
3-[3-oxo-3-(4-phenylbutan-2-ylamino)propyl]sulfanyl-N-(4-phenylbutan-2-yl)propanamide (PubChem CID 4172358) has the molecular formula C26H36N2O2S and a molecular weight of 440.65 g/mol. Its IUPAC name is 3-[3-oxo-3-(4-phenylbutan-2-ylamino)propyl]sulfanyl-N-(4-phenylbutan-2-yl)propanamide.
| Compound Name | 3-[3-oxo-3-(4-phenylbutan-2-ylamino)propyl]sulfanyl-N-(4-phenylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 4172358 |
| Molecular Formula | C26H36N2O2S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 3-[3-oxo-3-(4-phenylbutan-2-ylamino)propyl]sulfanyl-N-(4-phenylbutan-2-yl)propanamide |
| SMILES | CC(CCc1ccccc1)NC(=O)CCSCCC(=O)NC(C)CCc1ccccc1 |
| InChI | InChI=1S/C26H36N2O2S/c1-21(13-15-23-9-5-3-6-10-23)27-25(29)17-19-31-20-18-26(30)28-22(2)14-16-24-11-7-4-8-12-24/h3-12,21-22H,13-20H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | WGIPTKISAGOHBN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|