C14H21NOS — CID 19916451
3-benzylsulfanyl-N-butan-2-ylpropanamide (PubChem CID 19916451) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 3-benzylsulfanyl-N-butan-2-ylpropanamide.
| Compound Name | 3-benzylsulfanyl-N-butan-2-ylpropanamide |
|---|---|
| PubChem CID | 19916451 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-benzylsulfanyl-N-butan-2-ylpropanamide |
| SMILES | CCC(C)NC(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C14H21NOS/c1-3-12(2)15-14(16)9-10-17-11-13-7-5-4-6-8-13/h4-8,12H,3,9-11H2,1-2H3,(H,15,16) |
| InChIKey | MOSCWGMKJFCHSL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|