C21H27NOS — CID 133220086
3-benzylsulfanyl-N-[1-(2,4,5-trimethylphenyl)ethyl]propanamide (PubChem CID 133220086) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is 3-benzylsulfanyl-N-[1-(2,4,5-trimethylphenyl)ethyl]propanamide.
| Compound Name | 3-benzylsulfanyl-N-[1-(2,4,5-trimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 133220086 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 3-benzylsulfanyl-N-[1-(2,4,5-trimethylphenyl)ethyl]propanamide |
| SMILES | Cc1cc(C)c(C(C)NC(=O)CCSCc2ccccc2)cc1C |
| InChI | InChI=1S/C21H27NOS/c1-15-12-17(3)20(13-16(15)2)18(4)22-21(23)10-11-24-14-19-8-6-5-7-9-19/h5-9,12-13,18H,10-11,14H2,1-4H3,(H,22,23) |
| InChIKey | NTXJCEQUCMBLLA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|