C27H32N2O3S — CID 43906454
3-[4-(benzylsulfamoyl)phenyl]-N-[1-(2,4,5-trimethylphenyl)ethyl]propanamide (PubChem CID 43906454) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 3-[4-(benzylsulfamoyl)phenyl]-N-[1-(2,4,5-trimethylphenyl)ethyl]propanamide.
| Compound Name | 3-[4-(benzylsulfamoyl)phenyl]-N-[1-(2,4,5-trimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 43906454 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-[4-(benzylsulfamoyl)phenyl]-N-[1-(2,4,5-trimethylphenyl)ethyl]propanamide |
| SMILES | Cc1cc(C)c(C(C)NC(=O)CCc2ccc(S(=O)(=O)NCc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C27H32N2O3S/c1-19-16-21(3)26(17-20(19)2)22(4)29-27(30)15-12-23-10-13-25(14-11-23)33(31,32)28-18-24-8-6-5-7-9-24/h5-11,13-14,16-17,22,28H,12,15,18H2,1-4H3,(H,29,30) |
| InChIKey | XQEZCDFFNNLEEE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |