C26H30N2O4S — CID 30401789
2-[4-(benzylsulfamoyl)phenoxy]-N-[(1S)-1-(2,4,5-trimethylphenyl)ethyl]acetamide (PubChem CID 30401789) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is 2-[4-(benzylsulfamoyl)phenoxy]-N-[(1S)-1-(2,4,5-trimethylphenyl)ethyl]acetamide.
| Compound Name | 2-[4-(benzylsulfamoyl)phenoxy]-N-[(1S)-1-(2,4,5-trimethylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30401789 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-[4-(benzylsulfamoyl)phenoxy]-N-[(1S)-1-(2,4,5-trimethylphenyl)ethyl]acetamide |
| SMILES | Cc1cc(C)c([C@H](C)NC(=O)COc2ccc(S(=O)(=O)NCc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C26H30N2O4S/c1-18-14-20(3)25(15-19(18)2)21(4)28-26(29)17-32-23-10-12-24(13-11-23)33(30,31)27-16-22-8-6-5-7-9-22/h5-15,21,27H,16-17H2,1-4H3,(H,28,29)/t21-/m0/s1 |
| InChIKey | CEIABKOLRBRYMZ-NRFANRHFSA-N |
| XLogP | 4.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |