C18H20ClNOS — CID 42889731
3-[(3-chlorophenyl)methylsulfanyl]-N-(1-phenylethyl)propanamide (PubChem CID 42889731) has the molecular formula C18H20ClNOS and a molecular weight of 333.88 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylsulfanyl]-N-(1-phenylethyl)propanamide.
| Compound Name | 3-[(3-chlorophenyl)methylsulfanyl]-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 42889731 |
| Molecular Formula | C18H20ClNOS |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-[(3-chlorophenyl)methylsulfanyl]-N-(1-phenylethyl)propanamide |
| SMILES | CC(NC(=O)CCSCc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C18H20ClNOS/c1-14(16-7-3-2-4-8-16)20-18(21)10-11-22-13-15-6-5-9-17(19)12-15/h2-9,12,14H,10-11,13H2,1H3,(H,20,21) |
| InChIKey | VRKINVRTRRJMNC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|