C16H19ClN2OS2 — CID 42953335
N-[1-(3-chlorophenyl)ethyl]-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide (PubChem CID 42953335) has the molecular formula C16H19ClN2OS2 and a molecular weight of 354.93 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 42953335 |
| Molecular Formula | C16H19ClN2OS2 |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
| SMILES | Cc1nc(CSCCC(=O)NC(C)c2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C16H19ClN2OS2/c1-11(13-4-3-5-14(17)8-13)18-16(20)6-7-21-9-15-10-22-12(2)19-15/h3-5,8,10-11H,6-7,9H2,1-2H3,(H,18,20) |
| InChIKey | RDMPZVJQQBMWTP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|