C14H15ClN2OS2 — CID 16909032
N-(4-chlorophenyl)-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide (PubChem CID 16909032) has the molecular formula C14H15ClN2OS2 and a molecular weight of 326.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide.
| Compound Name | N-(4-chlorophenyl)-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 16909032 |
| Molecular Formula | C14H15ClN2OS2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
| SMILES | Cc1nc(CSCCC(=O)Nc2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C14H15ClN2OS2/c1-10-16-13(9-20-10)8-19-7-6-14(18)17-12-4-2-11(15)3-5-12/h2-5,9H,6-8H2,1H3,(H,17,18) |
| InChIKey | YGXQLTBMOIUTQL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|