C17H19Cl2N3O2S2 — CID 37351934
N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide (PubChem CID 37351934) has the molecular formula C17H19Cl2N3O2S2 and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 37351934 |
| Molecular Formula | C17H19Cl2N3O2S2 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
| SMILES | Cc1nc(CSCCC(=O)N(C)CC(=O)Nc2c(Cl)cccc2Cl)cs1 |
| InChI | InChI=1S/C17H19Cl2N3O2S2/c1-11-20-12(10-26-11)9-25-7-6-16(24)22(2)8-15(23)21-17-13(18)4-3-5-14(17)19/h3-5,10H,6-9H2,1-2H3,(H,21,23) |
| InChIKey | HMROUXNVGXRDIE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|