C13H18N4OS2 — CID 63939455
N-(1H-imidazol-2-ylmethyl)-N-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide (PubChem CID 63939455) has the molecular formula C13H18N4OS2 and a molecular weight of 310.45 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-N-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-N-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 63939455 |
| Molecular Formula | C13H18N4OS2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-N-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
| SMILES | Cc1nc(CSCCC(=O)N(C)Cc2ncc[nH]2)cs1 |
| InChI | InChI=1S/C13H18N4OS2/c1-10-16-11(9-20-10)8-19-6-3-13(18)17(2)7-12-14-4-5-15-12/h4-5,9H,3,6-8H2,1-2H3,(H,14,15) |
| InChIKey | GMDRZDNPILARRC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|