C12H15N3OS2 — CID 63939846
N-(1H-imidazol-2-ylmethyl)-N-methyl-2-(thiophen-2-ylmethylsulfanyl)acetamide (PubChem CID 63939846) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-N-methyl-2-(thiophen-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-N-methyl-2-(thiophen-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 63939846 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-N-methyl-2-(thiophen-2-ylmethylsulfanyl)acetamide |
| SMILES | CN(Cc1ncc[nH]1)C(=O)CSCc1cccs1 |
| InChI | InChI=1S/C12H15N3OS2/c1-15(7-11-13-4-5-14-11)12(16)9-17-8-10-3-2-6-18-10/h2-6H,7-9H2,1H3,(H,13,14) |
| InChIKey | RGPPOZOTHANAGE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |