C12H16N4O3S2 — CID 63939841
N-(1H-imidazol-2-ylmethyl)-N-methyl-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 63939841) has the molecular formula C12H16N4O3S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-N-methyl-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-N-methyl-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 63939841 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-N-methyl-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(Cc1ncc[nH]1)C(=O)CN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H16N4O3S2/c1-15(8-10-13-5-6-14-10)11(17)9-16(2)21(18,19)12-4-3-7-20-12/h3-7H,8-9H2,1-2H3,(H,13,14) |
| InChIKey | NMARWZFGOOFLDI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |