C13H16N2O3S3 — CID 18117309
N-methyl-2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 18117309) has the molecular formula C13H16N2O3S3 and a molecular weight of 344.48 g/mol. Its IUPAC name is N-methyl-2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | N-methyl-2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18117309 |
| Molecular Formula | C13H16N2O3S3 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | N-methyl-2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | CN(Cc1ccsc1)C(=O)CN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H16N2O3S3/c1-14(8-11-5-7-19-10-11)12(16)9-15(2)21(17,18)13-4-3-6-20-13/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | GQNYTVVISLSRQB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |