C7H11N3O3S2 — CID 76928975
N'-hydroxy-2-[methyl(thiophen-2-ylsulfonyl)amino]ethanimidamide (PubChem CID 76928975) has the molecular formula C7H11N3O3S2 and a molecular weight of 249.32 g/mol. Its IUPAC name is N'-hydroxy-2-[methyl(thiophen-2-ylsulfonyl)amino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[methyl(thiophen-2-ylsulfonyl)amino]ethanimidamide |
|---|---|
| PubChem CID | 76928975 |
| Molecular Formula | C7H11N3O3S2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | N'-hydroxy-2-[methyl(thiophen-2-ylsulfonyl)amino]ethanimidamide |
| SMILES | CN(CC(N)=NO)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C7H11N3O3S2/c1-10(5-6(8)9-11)15(12,13)7-3-2-4-14-7/h2-4,11H,5H2,1H3,(H2,8,9) |
| InChIKey | XJFZMVIHUFMBRQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|