C10H14N2O4S2 — CID 63105109
N-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-N-methylthiophene-2-sulfonamide (PubChem CID 63105109) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 63105109 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | N-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-N-methylthiophene-2-sulfonamide |
| SMILES | CN(CC(=O)N1CC(O)C1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C10H14N2O4S2/c1-11(7-9(14)12-5-8(13)6-12)18(15,16)10-3-2-4-17-10/h2-4,8,13H,5-7H2,1H3 |
| InChIKey | SOVDKODAHVOORW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |