C12H18N2O4S2 — CID 66260767
N-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide (PubChem CID 66260767) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66260767 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide |
| SMILES | CN(CC(=O)N1CCC[C@H]1CO)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-13(20(17,18)12-5-3-7-19-12)8-11(16)14-6-2-4-10(14)9-15/h3,5,7,10,15H,2,4,6,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | VPYJLRQVNHLMHL-JTQLQIEISA-N |
| XLogP | 0.35 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |