C9H13NO3S2 — CID 61408705
(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)methanol (PubChem CID 61408705) has the molecular formula C9H13NO3S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (1-thiophen-2-ylsulfonylpyrrolidin-2-yl)methanol.
| Compound Name | (1-thiophen-2-ylsulfonylpyrrolidin-2-yl)methanol |
|---|---|
| PubChem CID | 61408705 |
| Molecular Formula | C9H13NO3S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | (1-thiophen-2-ylsulfonylpyrrolidin-2-yl)methanol |
| SMILES | O=S(=O)(c1cccs1)N1CCCC1CO |
| InChI | InChI=1S/C9H13NO3S2/c11-7-8-3-1-5-10(8)15(12,13)9-4-2-6-14-9/h2,4,6,8,11H,1,3,5,7H2 |
| InChIKey | ZXCDFONPRNOARD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |