C10H15N3O3S2 — CID 77041831
N'-hydroxy-1-thiophen-2-ylsulfonylpiperidine-2-carboximidamide (PubChem CID 77041831) has the molecular formula C10H15N3O3S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N'-hydroxy-1-thiophen-2-ylsulfonylpiperidine-2-carboximidamide.
| Compound Name | N'-hydroxy-1-thiophen-2-ylsulfonylpiperidine-2-carboximidamide |
|---|---|
| PubChem CID | 77041831 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N'-hydroxy-1-thiophen-2-ylsulfonylpiperidine-2-carboximidamide |
| SMILES | NC(=NO)C1CCCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C10H15N3O3S2/c11-10(12-14)8-4-1-2-6-13(8)18(15,16)9-5-3-7-17-9/h3,5,7-8,14H,1-2,4,6H2,(H2,11,12) |
| InChIKey | RIDSGXSCQYFFSF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|