C21H21N3O4S3 — CID 16828820
N-(3-carbamoyl-5-phenylthiophen-2-yl)-1-thiophen-2-ylsulfonylpiperidine-2-carboxamide (PubChem CID 16828820) has the molecular formula C21H21N3O4S3 and a molecular weight of 475.62 g/mol. Its IUPAC name is N-(3-carbamoyl-5-phenylthiophen-2-yl)-1-thiophen-2-ylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-(3-carbamoyl-5-phenylthiophen-2-yl)-1-thiophen-2-ylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 16828820 |
| Molecular Formula | C21H21N3O4S3 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | N-(3-carbamoyl-5-phenylthiophen-2-yl)-1-thiophen-2-ylsulfonylpiperidine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)sc1NC(=O)C1CCCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H21N3O4S3/c22-19(25)15-13-17(14-7-2-1-3-8-14)30-21(15)23-20(26)16-9-4-5-11-24(16)31(27,28)18-10-6-12-29-18/h1-3,6-8,10,12-13,16H,4-5,9,11H2,(H2,22,25)(H,23,26) |
| InChIKey | LWWZCVYZWANJMC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |