C11H17N3O3S2 — CID 77036482
1-(5-ethylthiophen-2-yl)sulfonyl-N'-hydroxypyrrolidine-2-carboximidamide (PubChem CID 77036482) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-N'-hydroxypyrrolidine-2-carboximidamide.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-N'-hydroxypyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 77036482 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-N'-hydroxypyrrolidine-2-carboximidamide |
| SMILES | CCc1ccc(S(=O)(=O)N2CCCC2C(N)=NO)s1 |
| InChI | InChI=1S/C11H17N3O3S2/c1-2-8-5-6-10(18-8)19(16,17)14-7-3-4-9(14)11(12)13-15/h5-6,9,15H,2-4,7H2,1H3,(H2,12,13) |
| InChIKey | JSYHUHCMIZYKFI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|