C15H23NO3S2 — CID 79541588
1-[1-(5-ethylthiophen-2-yl)sulfonylazepan-2-yl]propan-2-one (PubChem CID 79541588) has the molecular formula C15H23NO3S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 1-[1-(5-ethylthiophen-2-yl)sulfonylazepan-2-yl]propan-2-one.
| Compound Name | 1-[1-(5-ethylthiophen-2-yl)sulfonylazepan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 79541588 |
| Molecular Formula | C15H23NO3S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-[1-(5-ethylthiophen-2-yl)sulfonylazepan-2-yl]propan-2-one |
| SMILES | CCc1ccc(S(=O)(=O)N2CCCCCC2CC(C)=O)s1 |
| InChI | InChI=1S/C15H23NO3S2/c1-3-14-8-9-15(20-14)21(18,19)16-10-6-4-5-7-13(16)11-12(2)17/h8-9,13H,3-7,10-11H2,1-2H3 |
| InChIKey | WFOKQBSFQLVLKJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |