C13H19NO4S2 — CID 62216799
3-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-2-yl]propanoic acid (PubChem CID 62216799) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-2-yl]propanoic acid.
| Compound Name | 3-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 62216799 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-2-yl]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2CCC(=O)O)s1 |
| InChI | InChI=1S/C13H19NO4S2/c1-10-5-8-13(19-10)20(17,18)14-9-3-2-4-11(14)6-7-12(15)16/h5,8,11H,2-4,6-7,9H2,1H3,(H,15,16) |
| InChIKey | IBINMQVOIPGYMV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |