C12H15BrClNO4S2 — CID 80577299
3-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidin-2-yl]propanoic acid (PubChem CID 80577299) has the molecular formula C12H15BrClNO4S2 and a molecular weight of 416.75 g/mol. Its IUPAC name is 3-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidin-2-yl]propanoic acid.
| Compound Name | 3-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 80577299 |
| Molecular Formula | C12H15BrClNO4S2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | 3-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidin-2-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCCN1S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C12H15BrClNO4S2/c13-12-9(14)7-11(20-12)21(18,19)15-6-2-1-3-8(15)4-5-10(16)17/h7-8H,1-6H2,(H,16,17) |
| InChIKey | KTTMLXQBDNAVED-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |