C10H11BrClNO4S2 — CID 80578410
1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 80578410) has the molecular formula C10H11BrClNO4S2 and a molecular weight of 388.69 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 80578410 |
| Molecular Formula | C10H11BrClNO4S2 |
| Molecular Weight | 388.69 g/mol |
| Exact Mass | 386.90 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C10H11BrClNO4S2/c11-9-6(12)5-8(18-9)19(16,17)13-4-2-1-3-7(13)10(14)15/h5,7H,1-4H2,(H,14,15) |
| InChIKey | IZRZKWCUACHFPA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.69 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |