C13H17BrClNO2S2 — CID 80578541
1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 80578541) has the molecular formula C13H17BrClNO2S2 and a molecular weight of 398.78 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 80578541 |
| Molecular Formula | C13H17BrClNO2S2 |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | O=S(=O)(c1cc(Cl)c(Br)s1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H17BrClNO2S2/c14-13-10(15)8-12(19-13)20(17,18)16-7-3-5-9-4-1-2-6-11(9)16/h8-9,11H,1-7H2 |
| InChIKey | JIEIPKLHUVVYJS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |