C15H19BrClNO2S — CID 106610949
1-(3-bromo-4-chlorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 106610949) has the molecular formula C15H19BrClNO2S and a molecular weight of 392.75 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(3-bromo-4-chlorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 106610949 |
| Molecular Formula | C15H19BrClNO2S |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | O=S(=O)(c1ccc(Cl)c(Br)c1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C15H19BrClNO2S/c16-13-10-12(7-8-14(13)17)21(19,20)18-9-3-5-11-4-1-2-6-15(11)18/h7-8,10-11,15H,1-6,9H2 |
| InChIKey | VKTKXKYFBJIYRM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |