C15H21ClN2O2S — CID 115329759
4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-2-chloroaniline (PubChem CID 115329759) has the molecular formula C15H21ClN2O2S and a molecular weight of 328.87 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-2-chloroaniline.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-2-chloroaniline |
|---|---|
| PubChem CID | 115329759 |
| Molecular Formula | C15H21ClN2O2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-2-chloroaniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCCC3CCCCC32)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O2S/c16-13-10-12(7-8-14(13)17)21(19,20)18-9-3-5-11-4-1-2-6-15(11)18/h7-8,10-11,15H,1-6,9,17H2 |
| InChIKey | RQALKUJDZXAVMF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|