C14H18ClNO2S — CID 70332287
(2S)-1-(4-chlorophenyl)sulfonyl-2-cyclopropylpiperidine (PubChem CID 70332287) has the molecular formula C14H18ClNO2S and a molecular weight of 299.82 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenyl)sulfonyl-2-cyclopropylpiperidine.
| Compound Name | (2S)-1-(4-chlorophenyl)sulfonyl-2-cyclopropylpiperidine |
|---|---|
| PubChem CID | 70332287 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (2S)-1-(4-chlorophenyl)sulfonyl-2-cyclopropylpiperidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCCC[C@H]1C1CC1 |
| InChI | InChI=1S/C14H18ClNO2S/c15-12-6-8-13(9-7-12)19(17,18)16-10-2-1-3-14(16)11-4-5-11/h6-9,11,14H,1-5,10H2/t14-/m0/s1 |
| InChIKey | PIWDSOKEMWFIKJ-AWEZNQCLSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |