C15H19Cl2NO2S — CID 11926516
(4aR,8aS)-1-(2,6-dichlorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 11926516) has the molecular formula C15H19Cl2NO2S and a molecular weight of 348.30 g/mol. Its IUPAC name is (4aR,8aS)-1-(2,6-dichlorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aR,8aS)-1-(2,6-dichlorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 11926516 |
| Molecular Formula | C15H19Cl2NO2S |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (4aR,8aS)-1-(2,6-dichlorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | O=S(=O)(c1c(Cl)cccc1Cl)N1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C15H19Cl2NO2S/c16-12-7-3-8-13(17)15(12)21(19,20)18-10-4-6-11-5-1-2-9-14(11)18/h3,7-8,11,14H,1-2,4-6,9-10H2/t11-,14+/m1/s1 |
| InChIKey | AWMGZFCVWLLTIW-RISCZKNCSA-N |
| XLogP | 4.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |