C10H10BrClN2O3S2 — CID 80578054
1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3-isocyanatopiperidine (PubChem CID 80578054) has the molecular formula C10H10BrClN2O3S2 and a molecular weight of 385.69 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3-isocyanatopiperidine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3-isocyanatopiperidine |
|---|---|
| PubChem CID | 80578054 |
| Molecular Formula | C10H10BrClN2O3S2 |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 383.90 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3-isocyanatopiperidine |
| SMILES | O=C=NC1CCCN(S(=O)(=O)c2cc(Cl)c(Br)s2)C1 |
| InChI | InChI=1S/C10H10BrClN2O3S2/c11-10-8(12)4-9(18-10)19(16,17)14-3-1-2-7(5-14)13-6-15/h4,7H,1-3,5H2 |
| InChIKey | ISVZEEBGRWOVOA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|