C10H12BrClN2O3S2 — CID 113402591
N-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpyrrolidin-3-yl]acetamide (PubChem CID 113402591) has the molecular formula C10H12BrClN2O3S2 and a molecular weight of 387.71 g/mol. Its IUPAC name is N-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 113402591 |
| Molecular Formula | C10H12BrClN2O3S2 |
| Molecular Weight | 387.71 g/mol |
| Exact Mass | 385.92 |
| IUPAC Name | N-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(S(=O)(=O)c2cc(Cl)c(Br)s2)C1 |
| InChI | InChI=1S/C10H12BrClN2O3S2/c1-6(15)13-7-2-3-14(5-7)19(16,17)9-4-8(12)10(11)18-9/h4,7H,2-3,5H2,1H3,(H,13,15) |
| InChIKey | QABZPOLOGXXZJF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.71 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |